[Ice-cream]

hey guys, can u help me with these few questions?

1. In the molecule below, which carbon atom is in the highest oxidation state?

BrCH2CH(OH)CH(OH)C(=O)CH2C(=O)OCH3

(I have NO idea of what to do!!! Can any1 help me?)

2. In the reduction of carbonyl compounds with LiALH4, the effective reducing species is: (a) Li+ (b) Al(3+) (c) AlH4(-) (d) AlH3 (e) H-

(i think the answer is c...any1 agree?)

3. What is the IUPAC name for the following compound?
CH3CH2CH2CH(Cl)C(=O)Cl
(a) 1-chloropentanoyl chloride
(b) 1-chloro-1-butanoyl chloride
(c) 2-chloropentanoyl chloride
(d) 1,2-dichloropentanal

(i think the answer is c...wat do u guys think?)

[Pirt]

Hey im not sure about the 1st question but your second answer is correct and for the 3rd question it depends if both cl atoms are on the same carbo which ni doubt because of the double bond oxygen on that carbon so the answer is (d).

Hope that helps

Pirt

[movies]

for the 3rd question it depends if both cl atoms are on the same carbo which ni doubt because of the double bond oxygen on that carbon so the answer is (d).

I think you mean that the answer should be (c).
For the answer to be (d) there must be an aldehyde.

For number 1, can you list all the possible oxidation states of carbon?  Then, can you assign each carbon in the molecule in question to one of these oxidation states?  Start with methane and assume that is the first oxidation state.