The way this 30 some year old book explains it, is basically like
The Hexane by itself would be
CH3-CH2-CH2-CH2-CH2-CH3
6 carbon, 14 hydrogen.
But then it starts talking about when adding groups you want to make the longest continously chain of carbon equal to 6.
CH2(2)-CH3(1)
|
CH3(6)-CH2(5)-CH2(4)CH(3)-CH3
And that's where I get lost. Why does the chain on the bottom lose a "CH2", wouldn't that kill the Hexane? Because wouldn't it be Hexane PLUS an methyl group molecule bonding with the original Hexane molecule?
My book doesn't explain this. So I figured, count the longest continuousted chain of carbons, right? But when I do, counting from to 6 above,
That equals 13 H.
If I count just the bottom chain it's 11 H.
I'm more than a little confused here.