hey guys, can u help me with these few questions?
1. In the molecule below, which carbon atom is in the highest oxidation state?
BrCH2CH(OH)CH(OH)C(=O)CH2C(=O)OCH3
(I have NO idea of what to do!!! Can any1 help me?)
2. In the reduction of carbonyl compounds with LiALH4, the effective reducing species is: (a) Li+ (b) Al(3+) (c) AlH4(-) (d) AlH3 (e) H-
(i think the answer is c...any1 agree?)
3. What is the IUPAC name for the following compound?
CH3CH2CH2CH(Cl)C(=O)Cl
(a) 1-chloropentanoyl chloride
(b) 1-chloro-1-butanoyl chloride
(c) 2-chloropentanoyl chloride
(d) 1,2-dichloropentanal
(i think the answer is c...wat do u guys think?)