TY for the answer ... Should i care about this https://imgur.com/a/x931G ?
Depends on what you mean by "not caring". B (which apparently stands for pyridine) is present there just to consume produced H
+, so the reaction that has to be balanced can be written either as
I
2 + SO
2 + H
2O + CH
2OH + B
BH
+ + I
- + CH
3OSO
3-or as
I
2 + 2SO
2 + H
2O + CH
2OH
H
+ + I
- + CH
3OSO
3-and both will give exactly the same stoichiometry (it is called Karl Fischer titration by the way).
Can it be right ? I2+SO2+H2O+CH2OH+3B=3BH(+)+2I(-)+CH3OSO3(-)
I am afraid not - for the reaction equation to be balanced you need exactly the same number of atoms and exactly the same charge on both sides of the equation. Count hydrogen atoms on both sides.
Note: you can use symbols (placed right above the edit field) to correctly format your equations, it makes them much easier to read.